C19H14ClF4N3O3 — CID 55365492
N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[3-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 55365492) has the molecular formula C19H14ClF4N3O3 and a molecular weight of 443.78 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[3-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[3-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 55365492 |
| Molecular Formula | C19H14ClF4N3O3 |
| Molecular Weight | 443.78 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-[3-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CC1C(=O)N(CC(=O)Nc2ccc(Cl)cc2C(F)(F)F)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H14ClF4N3O3/c1-10-17(29)26(18(30)27(10)13-5-3-12(21)4-6-13)9-16(28)25-15-7-2-11(20)8-14(15)19(22,23)24/h2-8,10H,9H2,1H3,(H,25,28) |
| InChIKey | FLFMODYDCFZKFS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.78 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|