C14H13ClN4O3 — CID 7181965
N-(3-chloro-4-cyanophenyl)-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 7181965) has the molecular formula C14H13ClN4O3 and a molecular weight of 320.74 g/mol. Its IUPAC name is N-(3-chloro-4-cyanophenyl)-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-(3-chloro-4-cyanophenyl)-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 7181965 |
| Molecular Formula | C14H13ClN4O3 |
| Molecular Weight | 320.74 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | N-(3-chloro-4-cyanophenyl)-2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CC1(C)NC(=O)N(CC(=O)Nc2ccc(C#N)c(Cl)c2)C1=O |
| InChI | InChI=1S/C14H13ClN4O3/c1-14(2)12(21)19(13(22)18-14)7-11(20)17-9-4-3-8(6-16)10(15)5-9/h3-5H,7H2,1-2H3,(H,17,20)(H,18,22) |
| InChIKey | IHHYKYOOMIYLIQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.74 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|