C15H17ClN4O2 — CID 2117238
2-(4-acetylpiperazin-1-yl)-N-(3-chloro-4-cyanophenyl)acetamide (PubChem CID 2117238) has the molecular formula C15H17ClN4O2 and a molecular weight of 320.78 g/mol. Its IUPAC name is 2-(4-acetylpiperazin-1-yl)-N-(3-chloro-4-cyanophenyl)acetamide.
| Compound Name | 2-(4-acetylpiperazin-1-yl)-N-(3-chloro-4-cyanophenyl)acetamide |
|---|---|
| PubChem CID | 2117238 |
| Molecular Formula | C15H17ClN4O2 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2-(4-acetylpiperazin-1-yl)-N-(3-chloro-4-cyanophenyl)acetamide |
| SMILES | CC(=O)N1CCN(CC(=O)Nc2ccc(C#N)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H17ClN4O2/c1-11(21)20-6-4-19(5-7-20)10-15(22)18-13-3-2-12(9-17)14(16)8-13/h2-3,8H,4-7,10H2,1H3,(H,18,22) |
| InChIKey | DFOXLRSUYMANKR-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |