C19H19ClN4O3S — CID 9104928
2-[4-(benzenesulfonyl)piperazin-1-yl]-N-(3-chloro-4-cyanophenyl)acetamide (PubChem CID 9104928) has the molecular formula C19H19ClN4O3S and a molecular weight of 418.91 g/mol. Its IUPAC name is 2-[4-(benzenesulfonyl)piperazin-1-yl]-N-(3-chloro-4-cyanophenyl)acetamide.
| Compound Name | 2-[4-(benzenesulfonyl)piperazin-1-yl]-N-(3-chloro-4-cyanophenyl)acetamide |
|---|---|
| PubChem CID | 9104928 |
| Molecular Formula | C19H19ClN4O3S |
| Molecular Weight | 418.91 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 2-[4-(benzenesulfonyl)piperazin-1-yl]-N-(3-chloro-4-cyanophenyl)acetamide |
| SMILES | N#Cc1ccc(NC(=O)CN2CCN(S(=O)(=O)c3ccccc3)CC2)cc1Cl |
| InChI | InChI=1S/C19H19ClN4O3S/c20-18-12-16(7-6-15(18)13-21)22-19(25)14-23-8-10-24(11-9-23)28(26,27)17-4-2-1-3-5-17/h1-7,12H,8-11,14H2,(H,22,25) |
| InChIKey | HUSSFTUYTKKXJH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.91 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |