C19H22ClN3O4S — CID 2655574
2-[4-(benzenesulfonyl)piperazin-1-yl]-N-(3-chloro-4-methoxyphenyl)acetamide (PubChem CID 2655574) has the molecular formula C19H22ClN3O4S and a molecular weight of 423.92 g/mol. Its IUPAC name is 2-[4-(benzenesulfonyl)piperazin-1-yl]-N-(3-chloro-4-methoxyphenyl)acetamide.
| Compound Name | 2-[4-(benzenesulfonyl)piperazin-1-yl]-N-(3-chloro-4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 2655574 |
| Molecular Formula | C19H22ClN3O4S |
| Molecular Weight | 423.92 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 2-[4-(benzenesulfonyl)piperazin-1-yl]-N-(3-chloro-4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CN2CCN(S(=O)(=O)c3ccccc3)CC2)cc1Cl |
| InChI | InChI=1S/C19H22ClN3O4S/c1-27-18-8-7-15(13-17(18)20)21-19(24)14-22-9-11-23(12-10-22)28(25,26)16-5-3-2-4-6-16/h2-8,13H,9-12,14H2,1H3,(H,21,24) |
| InChIKey | TVMWCWRICJXDIL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.92 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |