C17H17N3O4 — CID 26075366
N-(furan-2-ylmethyl)-2-[(4S)-4-methyl-2,5-dioxo-3-phenylimidazolidin-1-yl]acetamide (PubChem CID 26075366) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[(4S)-4-methyl-2,5-dioxo-3-phenylimidazolidin-1-yl]acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[(4S)-4-methyl-2,5-dioxo-3-phenylimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 26075366 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[(4S)-4-methyl-2,5-dioxo-3-phenylimidazolidin-1-yl]acetamide |
| SMILES | C[C@H]1C(=O)N(CC(=O)NCc2ccco2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C17H17N3O4/c1-12-16(22)19(11-15(21)18-10-14-8-5-9-24-14)17(23)20(12)13-6-3-2-4-7-13/h2-9,12H,10-11H2,1H3,(H,18,21)/t12-/m0/s1 |
| InChIKey | JPSDFGHWZXPBQE-LBPRGKRZSA-N |
| XLogP | 1.75 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|