C11H12N2O4 — CID 17034773
2-(2,5-dioxopyrrolidin-1-yl)-N-(furan-2-ylmethyl)acetamide (PubChem CID 17034773) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrolidin-1-yl)-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-(2,5-dioxopyrrolidin-1-yl)-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 17034773 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2-(2,5-dioxopyrrolidin-1-yl)-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(CN1C(=O)CCC1=O)NCc1ccco1 |
| InChI | InChI=1S/C11H12N2O4/c14-9(12-6-8-2-1-5-17-8)7-13-10(15)3-4-11(13)16/h1-2,5H,3-4,6-7H2,(H,12,14) |
| InChIKey | VYXPPGOEAUTUKV-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|