C17H22N4O5 — CID 34241212
2-[[2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-N-(furan-2-ylmethyl)acetamide (PubChem CID 34241212) has the molecular formula C17H22N4O5 and a molecular weight of 362.39 g/mol. Its IUPAC name is 2-[[2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[[2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 34241212 |
| Molecular Formula | C17H22N4O5 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 2-[[2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(CNC(=O)CN1C(=O)NC2(CCCCC2)C1=O)NCc1ccco1 |
| InChI | InChI=1S/C17H22N4O5/c22-13(18-9-12-5-4-8-26-12)10-19-14(23)11-21-15(24)17(20-16(21)25)6-2-1-3-7-17/h4-5,8H,1-3,6-7,9-11H2,(H,18,22)(H,19,23)(H,20,25) |
| InChIKey | HBRYEBRGRRVUFQ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|