C19H24N2O4 — CID 134025362
N-(furan-2-ylmethyl)-2-[1-[2-(furan-2-ylmethylamino)-2-oxoethyl]cyclopentyl]acetamide (PubChem CID 134025362) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[1-[2-(furan-2-ylmethylamino)-2-oxoethyl]cyclopentyl]acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[1-[2-(furan-2-ylmethylamino)-2-oxoethyl]cyclopentyl]acetamide |
|---|---|
| PubChem CID | 134025362 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[1-[2-(furan-2-ylmethylamino)-2-oxoethyl]cyclopentyl]acetamide |
| SMILES | O=C(CC1(CC(=O)NCc2ccco2)CCCC1)NCc1ccco1 |
| InChI | InChI=1S/C19H24N2O4/c22-17(20-13-15-5-3-9-24-15)11-19(7-1-2-8-19)12-18(23)21-14-16-6-4-10-25-16/h3-6,9-10H,1-2,7-8,11-14H2,(H,20,22)(H,21,23) |
| InChIKey | LDDDKPXEQAHUTK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |