C8H11N3O3 — CID 16772157
(3Z)-3-amino-N-(furan-2-ylmethyl)-3-hydroxyiminopropanamide (PubChem CID 16772157) has the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. Its IUPAC name is (3Z)-3-amino-N-(furan-2-ylmethyl)-3-hydroxyiminopropanamide.
| Compound Name | (3Z)-3-amino-N-(furan-2-ylmethyl)-3-hydroxyiminopropanamide |
|---|---|
| PubChem CID | 16772157 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | (3Z)-3-amino-N-(furan-2-ylmethyl)-3-hydroxyiminopropanamide |
| SMILES | N/C(CC(=O)NCc1ccco1)=N\O |
| InChI | InChI=1S/C8H11N3O3/c9-7(11-13)4-8(12)10-5-6-2-1-3-14-6/h1-3,13H,4-5H2,(H2,9,11)(H,10,12) |
| InChIKey | XDQMQKGEIGSZSJ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 100.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|