C11H17IN4O2 — CID 110914043
2-[[amino-(prop-2-enylamino)methylidene]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide (PubChem CID 110914043) has the molecular formula C11H17IN4O2 and a molecular weight of 364.19 g/mol. Its IUPAC name is 2-[[amino-(prop-2-enylamino)methylidene]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide.
| Compound Name | 2-[[amino-(prop-2-enylamino)methylidene]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 110914043 |
| Molecular Formula | C11H17IN4O2 |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 2-[[amino-(prop-2-enylamino)methylidene]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide |
| SMILES | C=CCN/C(N)=N/CC(=O)NCc1ccco1.I |
| InChI | InChI=1S/C11H16N4O2.HI/c1-2-5-13-11(12)15-8-10(16)14-7-9-4-3-6-17-9;/h2-4,6H,1,5,7-8H2,(H,14,16)(H3,12,13,15);1H |
| InChIKey | FXAOOPWRYGMPQJ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|