C15H20IN5O2 — CID 111035913
2-[[amino-(2-pyridin-2-ylethylamino)methylidene]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide (PubChem CID 111035913) has the molecular formula C15H20IN5O2 and a molecular weight of 429.26 g/mol. Its IUPAC name is 2-[[amino-(2-pyridin-2-ylethylamino)methylidene]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide.
| Compound Name | 2-[[amino-(2-pyridin-2-ylethylamino)methylidene]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111035913 |
| Molecular Formula | C15H20IN5O2 |
| Molecular Weight | 429.26 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 2-[[amino-(2-pyridin-2-ylethylamino)methylidene]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide |
| SMILES | I.N/C(=N\CC(=O)NCc1ccco1)NCCc1ccccn1 |
| InChI | InChI=1S/C15H19N5O2.HI/c16-15(18-8-6-12-4-1-2-7-17-12)20-11-14(21)19-10-13-5-3-9-22-13;/h1-5,7,9H,6,8,10-11H2,(H,19,21)(H3,16,18,20);1H |
| InChIKey | GTLMFYDFYYCIEH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|