C22H26N4O — CID 111134399
2-[2-(furan-2-yl)ethyl]-1-(2-phenylethyl)-3-(2-pyridin-2-ylethyl)guanidine (PubChem CID 111134399) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is 2-[2-(furan-2-yl)ethyl]-1-(2-phenylethyl)-3-(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 2-[2-(furan-2-yl)ethyl]-1-(2-phenylethyl)-3-(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111134399 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 2-[2-(furan-2-yl)ethyl]-1-(2-phenylethyl)-3-(2-pyridin-2-ylethyl)guanidine |
| SMILES | c1ccc(CCN/C(=N\CCc2ccco2)NCCc2ccccn2)cc1 |
| InChI | InChI=1S/C22H26N4O/c1-2-7-19(8-3-1)11-15-24-22(26-17-13-21-10-6-18-27-21)25-16-12-20-9-4-5-14-23-20/h1-10,14,18H,11-13,15-17H2,(H2,24,25,26) |
| InChIKey | WVJOVGLJANMCIW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|