C22H26N6 — CID 102500512
1,2,3-tris(2-pyridin-2-ylethyl)guanidine (PubChem CID 102500512) has the molecular formula C22H26N6 and a molecular weight of 374.49 g/mol. Its IUPAC name is 1,2,3-tris(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 1,2,3-tris(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 102500512 |
| Molecular Formula | C22H26N6 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 1,2,3-tris(2-pyridin-2-ylethyl)guanidine |
| SMILES | c1ccc(CCN=C(NCCc2ccccn2)NCCc2ccccn2)nc1 |
| InChI | InChI=1S/C22H26N6/c1-4-13-23-19(7-1)10-16-26-22(27-17-11-20-8-2-5-14-24-20)28-18-12-21-9-3-6-15-25-21/h1-9,13-15H,10-12,16-18H2,(H2,26,27,28) |
| InChIKey | NEQBXPKMJWBVFB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|