C20H23N5O3S — CID 110970313
1-[2-(furan-2-yl)ethyl]-3-(pyridin-2-ylmethyl)-2-[(4-sulfamoylphenyl)methyl]guanidine (PubChem CID 110970313) has the molecular formula C20H23N5O3S and a molecular weight of 413.50 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-3-(pyridin-2-ylmethyl)-2-[(4-sulfamoylphenyl)methyl]guanidine.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-3-(pyridin-2-ylmethyl)-2-[(4-sulfamoylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 110970313 |
| Molecular Formula | C20H23N5O3S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-3-(pyridin-2-ylmethyl)-2-[(4-sulfamoylphenyl)methyl]guanidine |
| SMILES | NS(=O)(=O)c1ccc(C/N=C(\NCCc2ccco2)NCc2ccccn2)cc1 |
| InChI | InChI=1S/C20H23N5O3S/c21-29(26,27)19-8-6-16(7-9-19)14-24-20(23-12-10-18-5-3-13-28-18)25-15-17-4-1-2-11-22-17/h1-9,11,13H,10,12,14-15H2,(H2,21,26,27)(H2,23,24,25) |
| InChIKey | KLXOWNYLZHHHJQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 122.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|