C17H24N4O3S2 — CID 111343623
1-[2-(furan-2-yl)ethyl]-3-(2-methylsulfanylethyl)-2-[(4-sulfamoylphenyl)methyl]guanidine (PubChem CID 111343623) has the molecular formula C17H24N4O3S2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-3-(2-methylsulfanylethyl)-2-[(4-sulfamoylphenyl)methyl]guanidine.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-3-(2-methylsulfanylethyl)-2-[(4-sulfamoylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111343623 |
| Molecular Formula | C17H24N4O3S2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-3-(2-methylsulfanylethyl)-2-[(4-sulfamoylphenyl)methyl]guanidine |
| SMILES | CSCCN/C(=N\Cc1ccc(S(N)(=O)=O)cc1)NCCc1ccco1 |
| InChI | InChI=1S/C17H24N4O3S2/c1-25-12-10-20-17(19-9-8-15-3-2-11-24-15)21-13-14-4-6-16(7-5-14)26(18,22)23/h2-7,11H,8-10,12-13H2,1H3,(H2,18,22,23)(H2,19,20,21) |
| InChIKey | ASZPPMFIDYYQGT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|