C22H27IN4O4S — CID 111218176
1-[2-(furan-2-yl)ethyl]-3-[(2-methoxyphenyl)methyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111218176) has the molecular formula C22H27IN4O4S and a molecular weight of 570.45 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-3-[(2-methoxyphenyl)methyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-3-[(2-methoxyphenyl)methyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111218176 |
| Molecular Formula | C22H27IN4O4S |
| Molecular Weight | 570.45 g/mol |
| Exact Mass | 570.08 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-3-[(2-methoxyphenyl)methyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
| SMILES | COc1ccccc1CN/C(=N/Cc1ccc(S(N)(=O)=O)cc1)NCCc1ccco1.I |
| InChI | InChI=1S/C22H26N4O4S.HI/c1-29-21-7-3-2-5-18(21)16-26-22(24-13-12-19-6-4-14-30-19)25-15-17-8-10-20(11-9-17)31(23,27)28;/h2-11,14H,12-13,15-16H2,1H3,(H2,23,27,28)(H2,24,25,26);1H |
| InChIKey | XBRNWPAKTYUYEI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|