C21H33IN4O4S — CID 111240850
1-(3-butoxypropyl)-3-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111240850) has the molecular formula C21H33IN4O4S and a molecular weight of 564.49 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-3-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-butoxypropyl)-3-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111240850 |
| Molecular Formula | C21H33IN4O4S |
| Molecular Weight | 564.49 g/mol |
| Exact Mass | 564.13 |
| IUPAC Name | 1-(3-butoxypropyl)-3-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCCCOCCCN/C(=N\Cc1ccc(S(N)(=O)=O)cc1)NCCc1ccco1.I |
| InChI | InChI=1S/C21H32N4O4S.HI/c1-2-3-14-28-15-5-12-23-21(24-13-11-19-6-4-16-29-19)25-17-18-7-9-20(10-8-18)30(22,26)27;/h4,6-10,16H,2-3,5,11-15,17H2,1H3,(H2,22,26,27)(H2,23,24,25);1H |
| InChIKey | DTRBIHCDTAKZNA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|