C16H29IN4O4S — CID 111405304
1-ethyl-3-[3-(2-methoxyethoxy)propyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111405304) has the molecular formula C16H29IN4O4S and a molecular weight of 500.40 g/mol. Its IUPAC name is 1-ethyl-3-[3-(2-methoxyethoxy)propyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(2-methoxyethoxy)propyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111405304 |
| Molecular Formula | C16H29IN4O4S |
| Molecular Weight | 500.40 g/mol |
| Exact Mass | 500.10 |
| IUPAC Name | 1-ethyl-3-[3-(2-methoxyethoxy)propyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(S(N)(=O)=O)cc1)NCCCOCCOC.I |
| InChI | InChI=1S/C16H28N4O4S.HI/c1-3-18-16(19-9-4-10-24-12-11-23-2)20-13-14-5-7-15(8-6-14)25(17,21)22;/h5-8H,3-4,9-13H2,1-2H3,(H2,17,21,22)(H2,18,19,20);1H |
| InChIKey | BRFVYDJVPMAGSH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.40 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|