C19H34IN5O4S — CID 111240854
2-[[N-(3-butoxypropyl)-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111240854) has the molecular formula C19H34IN5O4S and a molecular weight of 555.48 g/mol. Its IUPAC name is 2-[[N-(3-butoxypropyl)-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N-(3-butoxypropyl)-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111240854 |
| Molecular Formula | C19H34IN5O4S |
| Molecular Weight | 555.48 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | 2-[[N-(3-butoxypropyl)-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCCCOCCCN/C(=N\Cc1ccc(S(N)(=O)=O)cc1)NCC(=O)N(C)C.I |
| InChI | InChI=1S/C19H33N5O4S.HI/c1-4-5-12-28-13-6-11-21-19(23-15-18(25)24(2)3)22-14-16-7-9-17(10-8-16)29(20,26)27;/h7-10H,4-6,11-15H2,1-3H3,(H2,20,26,27)(H2,21,22,23);1H |
| InChIKey | CBLDUWHPIWMVNB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 126.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.48 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|