C18H31N5O3S — CID 111161313
2-[[N-hexyl-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 111161313) has the molecular formula C18H31N5O3S and a molecular weight of 397.55 g/mol. Its IUPAC name is 2-[[N-hexyl-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N-hexyl-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111161313 |
| Molecular Formula | C18H31N5O3S |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 2-[[N-hexyl-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | CCCCCCN/C(=N\Cc1ccc(S(N)(=O)=O)cc1)NCC(=O)N(C)C |
| InChI | InChI=1S/C18H31N5O3S/c1-4-5-6-7-12-20-18(22-14-17(24)23(2)3)21-13-15-8-10-16(11-9-15)27(19,25)26/h8-11H,4-7,12-14H2,1-3H3,(H2,19,25,26)(H2,20,21,22) |
| InChIKey | XSPHFXXUPIREHZ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|