C17H29N5O3S — CID 110978839
N,N-dimethyl-2-[[N-(3-methylbutyl)-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]acetamide (PubChem CID 110978839) has the molecular formula C17H29N5O3S and a molecular weight of 383.52 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N-(3-methylbutyl)-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[N-(3-methylbutyl)-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 110978839 |
| Molecular Formula | C17H29N5O3S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N,N-dimethyl-2-[[N-(3-methylbutyl)-N'-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]acetamide |
| SMILES | CC(C)CCN/C(=N\Cc1ccc(S(N)(=O)=O)cc1)NCC(=O)N(C)C |
| InChI | InChI=1S/C17H29N5O3S/c1-13(2)9-10-19-17(21-12-16(23)22(3)4)20-11-14-5-7-15(8-6-14)26(18,24)25/h5-8,13H,9-12H2,1-4H3,(H2,18,24,25)(H2,19,20,21) |
| InChIKey | ORMLTFLPECPKOK-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|