C19H24ClN5O3S — CID 111131452
2-[[N'-[(4-chlorophenyl)methyl]-N-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 111131452) has the molecular formula C19H24ClN5O3S and a molecular weight of 437.95 g/mol. Its IUPAC name is 2-[[N'-[(4-chlorophenyl)methyl]-N-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N'-[(4-chlorophenyl)methyl]-N-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111131452 |
| Molecular Formula | C19H24ClN5O3S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 2-[[N'-[(4-chlorophenyl)methyl]-N-[(4-sulfamoylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN/C(=N\Cc1ccc(Cl)cc1)NCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C19H24ClN5O3S/c1-25(2)18(26)13-24-19(22-11-14-3-7-16(20)8-4-14)23-12-15-5-9-17(10-6-15)29(21,27)28/h3-10H,11-13H2,1-2H3,(H2,21,27,28)(H2,22,23,24) |
| InChIKey | YGGHXAYMZOZGFN-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|