C15H23ClN4O — CID 111766187
2-[[N'-[(4-chlorophenyl)methyl]-N-propylcarbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 111766187) has the molecular formula C15H23ClN4O and a molecular weight of 310.83 g/mol. Its IUPAC name is 2-[[N'-[(4-chlorophenyl)methyl]-N-propylcarbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N'-[(4-chlorophenyl)methyl]-N-propylcarbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111766187 |
| Molecular Formula | C15H23ClN4O |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 2-[[N'-[(4-chlorophenyl)methyl]-N-propylcarbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | CCCN/C(=N\Cc1ccc(Cl)cc1)NCC(=O)N(C)C |
| InChI | InChI=1S/C15H23ClN4O/c1-4-9-17-15(19-11-14(21)20(2)3)18-10-12-5-7-13(16)8-6-12/h5-8H,4,9-11H2,1-3H3,(H2,17,18,19) |
| InChIKey | NIFILLFABPWTKV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|