C15H24IN5O3 — CID 111777806
N,N-dimethyl-2-[[N'-[(4-nitrophenyl)methyl]-N-propylcarbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111777806) has the molecular formula C15H24IN5O3 and a molecular weight of 449.29 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N'-[(4-nitrophenyl)methyl]-N-propylcarbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[N'-[(4-nitrophenyl)methyl]-N-propylcarbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111777806 |
| Molecular Formula | C15H24IN5O3 |
| Molecular Weight | 449.29 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | N,N-dimethyl-2-[[N'-[(4-nitrophenyl)methyl]-N-propylcarbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | CCCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)NCC(=O)N(C)C.I |
| InChI | InChI=1S/C15H23N5O3.HI/c1-4-9-16-15(18-11-14(21)19(2)3)17-10-12-5-7-13(8-6-12)20(22)23;/h5-8H,4,9-11H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | DHVBUWMJVRIILU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|