C19H23ClIN5O3 — CID 111899792
2-[[N'-[(3-chlorophenyl)methyl]-N-[(4-nitrophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111899792) has the molecular formula C19H23ClIN5O3 and a molecular weight of 531.78 g/mol. Its IUPAC name is 2-[[N'-[(3-chlorophenyl)methyl]-N-[(4-nitrophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N'-[(3-chlorophenyl)methyl]-N-[(4-nitrophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111899792 |
| Molecular Formula | C19H23ClIN5O3 |
| Molecular Weight | 531.78 g/mol |
| Exact Mass | 531.05 |
| IUPAC Name | 2-[[N'-[(3-chlorophenyl)methyl]-N-[(4-nitrophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CN(C)C(=O)CN/C(=N\Cc1cccc(Cl)c1)NCc1ccc([N+](=O)[O-])cc1.I |
| InChI | InChI=1S/C19H22ClN5O3.HI/c1-24(2)18(26)13-23-19(22-12-15-4-3-5-16(20)10-15)21-11-14-6-8-17(9-7-14)25(27)28;/h3-10H,11-13H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | YOGKBNLSTLSMIL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.78 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|