C21H27N5O5 — CID 111903623
2-[[N'-[(3,4-dimethoxyphenyl)methyl]-N-[(4-nitrophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 111903623) has the molecular formula C21H27N5O5 and a molecular weight of 429.48 g/mol. Its IUPAC name is 2-[[N'-[(3,4-dimethoxyphenyl)methyl]-N-[(4-nitrophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N'-[(3,4-dimethoxyphenyl)methyl]-N-[(4-nitrophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111903623 |
| Molecular Formula | C21H27N5O5 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 2-[[N'-[(3,4-dimethoxyphenyl)methyl]-N-[(4-nitrophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | COc1ccc(C/N=C(\NCC(=O)N(C)C)NCc2ccc([N+](=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C21H27N5O5/c1-25(2)20(27)14-24-21(22-12-15-5-8-17(9-6-15)26(28)29)23-13-16-7-10-18(30-3)19(11-16)31-4/h5-11H,12-14H2,1-4H3,(H2,22,23,24) |
| InChIKey | VJNKKWVKQGQCGM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 118.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|