C21H28IN5O4 — CID 111907162
2-[[N-[2-(2-methoxyphenyl)ethyl]-N'-[(4-nitrophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111907162) has the molecular formula C21H28IN5O4 and a molecular weight of 541.39 g/mol. Its IUPAC name is 2-[[N-[2-(2-methoxyphenyl)ethyl]-N'-[(4-nitrophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N-[2-(2-methoxyphenyl)ethyl]-N'-[(4-nitrophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111907162 |
| Molecular Formula | C21H28IN5O4 |
| Molecular Weight | 541.39 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | 2-[[N-[2-(2-methoxyphenyl)ethyl]-N'-[(4-nitrophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | COc1ccccc1CCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)NCC(=O)N(C)C.I |
| InChI | InChI=1S/C21H27N5O4.HI/c1-25(2)20(27)15-24-21(22-13-12-17-6-4-5-7-19(17)30-3)23-14-16-8-10-18(11-9-16)26(28)29;/h4-11H,12-15H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | WWDXRNYVLHMACE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|