C23H29N5O2 — CID 110033733
2-[[N'-benzyl-N-[2-(4-methoxy-1H-indol-3-yl)ethyl]carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 110033733) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 2-[[N'-benzyl-N-[2-(4-methoxy-1H-indol-3-yl)ethyl]carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N'-benzyl-N-[2-(4-methoxy-1H-indol-3-yl)ethyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110033733 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 2-[[N'-benzyl-N-[2-(4-methoxy-1H-indol-3-yl)ethyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | COc1cccc2[nH]cc(CCN/C(=N/Cc3ccccc3)NCC(=O)N(C)C)c12 |
| InChI | InChI=1S/C23H29N5O2/c1-28(2)21(29)16-27-23(26-14-17-8-5-4-6-9-17)24-13-12-18-15-25-19-10-7-11-20(30-3)22(18)19/h4-11,15,25H,12-14,16H2,1-3H3,(H2,24,26,27) |
| InChIKey | VATSACJSVKYWAF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|