C21H34IN5O3 — CID 110034206
2-[[(3-ethoxypropylamino)-[2-(4-methoxy-1H-indol-3-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110034206) has the molecular formula C21H34IN5O3 and a molecular weight of 531.44 g/mol. Its IUPAC name is 2-[[(3-ethoxypropylamino)-[2-(4-methoxy-1H-indol-3-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(3-ethoxypropylamino)-[2-(4-methoxy-1H-indol-3-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110034206 |
| Molecular Formula | C21H34IN5O3 |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | 2-[[(3-ethoxypropylamino)-[2-(4-methoxy-1H-indol-3-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCOCCCN/C(=N\CC(=O)N(C)C)NCCc1c[nH]c2cccc(OC)c12.I |
| InChI | InChI=1S/C21H33N5O3.HI/c1-5-29-13-7-11-22-21(25-15-19(27)26(2)3)23-12-10-16-14-24-17-8-6-9-18(28-4)20(16)17;/h6,8-9,14,24H,5,7,10-13,15H2,1-4H3,(H2,22,23,25);1H |
| InChIKey | ODTPQFNKWCXUKK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|