C22H29N5OS — CID 111862975
N,N-dimethyl-2-[[[2-(4-methyl-1H-indol-3-yl)ethylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide (PubChem CID 111862975) has the molecular formula C22H29N5OS and a molecular weight of 411.58 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[2-(4-methyl-1H-indol-3-yl)ethylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[2-(4-methyl-1H-indol-3-yl)ethylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111862975 |
| Molecular Formula | C22H29N5OS |
| Molecular Weight | 411.58 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | N,N-dimethyl-2-[[[2-(4-methyl-1H-indol-3-yl)ethylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]acetamide |
| SMILES | Cc1cccc2[nH]cc(CCN/C(=N/CC(=O)N(C)C)NCCc3cccs3)c12 |
| InChI | InChI=1S/C22H29N5OS/c1-16-6-4-8-19-21(16)17(14-25-19)9-11-23-22(26-15-20(28)27(2)3)24-12-10-18-7-5-13-29-18/h4-8,13-14,25H,9-12,15H2,1-3H3,(H2,23,24,26) |
| InChIKey | ZUGTUTBRXTVXFI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.58 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|