C23H30F2N4O3 — CID 110045801
2-[[N'-[[2-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N-(2-phenylethyl)carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 110045801) has the molecular formula C23H30F2N4O3 and a molecular weight of 448.51 g/mol. Its IUPAC name is 2-[[N'-[[2-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N-(2-phenylethyl)carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N'-[[2-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N-(2-phenylethyl)carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110045801 |
| Molecular Formula | C23H30F2N4O3 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 2-[[N'-[[2-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N-(2-phenylethyl)carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | CCOc1cccc(C/N=C(\NCCc2ccccc2)NCC(=O)N(C)C)c1OC(F)F |
| InChI | InChI=1S/C23H30F2N4O3/c1-4-31-19-12-8-11-18(21(19)32-22(24)25)15-27-23(28-16-20(30)29(2)3)26-14-13-17-9-6-5-7-10-17/h5-12,22H,4,13-16H2,1-3H3,(H2,26,27,28) |
| InChIKey | WXLXEJWGIRQMCI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|