C22H27F2IN4O4 — CID 110045922
2-[[N'-[[6-(difluoromethoxy)-1,3-benzodioxol-5-yl]methyl]-N-(2-phenylethyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110045922) has the molecular formula C22H27F2IN4O4 and a molecular weight of 576.38 g/mol. Its IUPAC name is 2-[[N'-[[6-(difluoromethoxy)-1,3-benzodioxol-5-yl]methyl]-N-(2-phenylethyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N'-[[6-(difluoromethoxy)-1,3-benzodioxol-5-yl]methyl]-N-(2-phenylethyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110045922 |
| Molecular Formula | C22H27F2IN4O4 |
| Molecular Weight | 576.38 g/mol |
| Exact Mass | 576.10 |
| IUPAC Name | 2-[[N'-[[6-(difluoromethoxy)-1,3-benzodioxol-5-yl]methyl]-N-(2-phenylethyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CN(C)C(=O)CN/C(=N/Cc1cc2c(cc1OC(F)F)OCO2)NCCc1ccccc1.I |
| InChI | InChI=1S/C22H26F2N4O4.HI/c1-28(2)20(29)13-27-22(25-9-8-15-6-4-3-5-7-15)26-12-16-10-18-19(31-14-30-18)11-17(16)32-21(23)24;/h3-7,10-11,21H,8-9,12-14H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | IFZBOUUFLRAVEY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|