C20H23F2N3O4 — CID 110058936
2-[[6-(difluoromethoxy)-1,3-benzodioxol-5-yl]methyl]-1-[2-(furan-2-yl)ethyl]-3-(2-methylprop-2-enyl)guanidine (PubChem CID 110058936) has the molecular formula C20H23F2N3O4 and a molecular weight of 407.42 g/mol. Its IUPAC name is 2-[[6-(difluoromethoxy)-1,3-benzodioxol-5-yl]methyl]-1-[2-(furan-2-yl)ethyl]-3-(2-methylprop-2-enyl)guanidine.
| Compound Name | 2-[[6-(difluoromethoxy)-1,3-benzodioxol-5-yl]methyl]-1-[2-(furan-2-yl)ethyl]-3-(2-methylprop-2-enyl)guanidine |
|---|---|
| PubChem CID | 110058936 |
| Molecular Formula | C20H23F2N3O4 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 2-[[6-(difluoromethoxy)-1,3-benzodioxol-5-yl]methyl]-1-[2-(furan-2-yl)ethyl]-3-(2-methylprop-2-enyl)guanidine |
| SMILES | C=C(C)CN/C(=N/Cc1cc2c(cc1OC(F)F)OCO2)NCCc1ccco1 |
| InChI | InChI=1S/C20H23F2N3O4/c1-13(2)10-24-20(23-6-5-15-4-3-7-26-15)25-11-14-8-17-18(28-12-27-17)9-16(14)29-19(21)22/h3-4,7-9,19H,1,5-6,10-12H2,2H3,(H2,23,24,25) |
| InChIKey | GEUJNSNAXYYQKM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|