C21H29F2N3O4 — CID 110058958
2-[[2-(difluoromethoxy)-5-methoxyphenyl]methyl]-1-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]guanidine (PubChem CID 110058958) has the molecular formula C21H29F2N3O4 and a molecular weight of 425.48 g/mol. Its IUPAC name is 2-[[2-(difluoromethoxy)-5-methoxyphenyl]methyl]-1-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]guanidine.
| Compound Name | 2-[[2-(difluoromethoxy)-5-methoxyphenyl]methyl]-1-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 110058958 |
| Molecular Formula | C21H29F2N3O4 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 2-[[2-(difluoromethoxy)-5-methoxyphenyl]methyl]-1-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]guanidine |
| SMILES | CCOCCCN/C(=N\Cc1cc(OC)ccc1OC(F)F)NCCc1ccco1 |
| InChI | InChI=1S/C21H29F2N3O4/c1-3-28-12-5-10-24-21(25-11-9-17-6-4-13-29-17)26-15-16-14-18(27-2)7-8-19(16)30-20(22)23/h4,6-8,13-14,20H,3,5,9-12,15H2,1-2H3,(H2,24,25,26) |
| InChIKey | BEDXMSFDCHWTPD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|