C19H24ClFIN3O2 — CID 136701220
2-[2-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-1-[2-(furan-2-yl)ethyl]-3-(2-methylprop-2-enyl)guanidine;hydroiodide (PubChem CID 136701220) has the molecular formula C19H24ClFIN3O2 and a molecular weight of 507.78 g/mol. Its IUPAC name is 2-[2-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-1-[2-(furan-2-yl)ethyl]-3-(2-methylprop-2-enyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-1-[2-(furan-2-yl)ethyl]-3-(2-methylprop-2-enyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 136701220 |
| Molecular Formula | C19H24ClFIN3O2 |
| Molecular Weight | 507.78 g/mol |
| Exact Mass | 507.06 |
| IUPAC Name | 2-[2-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-1-[2-(furan-2-yl)ethyl]-3-(2-methylprop-2-enyl)guanidine;hydroiodide |
| SMILES | C=C(C)CN/C(=N/CC(O)c1ccc(Cl)c(F)c1)NCCc1ccco1.I |
| InChI | InChI=1S/C19H23ClFN3O2.HI/c1-13(2)11-23-19(22-8-7-15-4-3-9-26-15)24-12-18(25)14-5-6-16(20)17(21)10-14;/h3-6,9-10,18,25H,1,7-8,11-12H2,2H3,(H2,22,23,24);1H |
| InChIKey | LUVTWVNEJAVJKP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.78 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|