C18H23ClFN3O2S — CID 110051270
2-[2-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-1-[2-(furan-2-yl)ethyl]-3-(2-methylsulfanylethyl)guanidine (PubChem CID 110051270) has the molecular formula C18H23ClFN3O2S and a molecular weight of 399.92 g/mol. Its IUPAC name is 2-[2-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-1-[2-(furan-2-yl)ethyl]-3-(2-methylsulfanylethyl)guanidine.
| Compound Name | 2-[2-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-1-[2-(furan-2-yl)ethyl]-3-(2-methylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 110051270 |
| Molecular Formula | C18H23ClFN3O2S |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 2-[2-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-1-[2-(furan-2-yl)ethyl]-3-(2-methylsulfanylethyl)guanidine |
| SMILES | CSCCN/C(=N\CC(O)c1ccc(Cl)c(F)c1)NCCc1ccco1 |
| InChI | InChI=1S/C18H23ClFN3O2S/c1-26-10-8-22-18(21-7-6-14-3-2-9-25-14)23-12-17(24)13-4-5-15(19)16(20)11-13/h2-5,9,11,17,24H,6-8,10,12H2,1H3,(H2,21,22,23) |
| InChIKey | LRDZBXOTTUDYRY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|