C17H28IN5OS — CID 110050593
2-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1-[2-(furan-2-yl)ethyl]-3-(2-methylsulfanylethyl)guanidine;hydroiodide (PubChem CID 110050593) has the molecular formula C17H28IN5OS and a molecular weight of 477.42 g/mol. Its IUPAC name is 2-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1-[2-(furan-2-yl)ethyl]-3-(2-methylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 2-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1-[2-(furan-2-yl)ethyl]-3-(2-methylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110050593 |
| Molecular Formula | C17H28IN5OS |
| Molecular Weight | 477.42 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 2-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1-[2-(furan-2-yl)ethyl]-3-(2-methylsulfanylethyl)guanidine;hydroiodide |
| SMILES | CCc1nn(C)cc1C/N=C(\NCCSC)NCCc1ccco1.I |
| InChI | InChI=1S/C17H27N5OS.HI/c1-4-16-14(13-22(2)21-16)12-20-17(19-9-11-24-3)18-8-7-15-6-5-10-23-15;/h5-6,10,13H,4,7-9,11-12H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | PTKCTSCTJAQEJM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 67.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|