C22H29N5O — CID 110051794
1-butan-2-yl-3-[2-(furan-2-yl)ethyl]-2-[(1-methyl-3-phenylpyrazol-4-yl)methyl]guanidine (PubChem CID 110051794) has the molecular formula C22H29N5O and a molecular weight of 379.51 g/mol. Its IUPAC name is 1-butan-2-yl-3-[2-(furan-2-yl)ethyl]-2-[(1-methyl-3-phenylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 1-butan-2-yl-3-[2-(furan-2-yl)ethyl]-2-[(1-methyl-3-phenylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 110051794 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 1-butan-2-yl-3-[2-(furan-2-yl)ethyl]-2-[(1-methyl-3-phenylpyrazol-4-yl)methyl]guanidine |
| SMILES | CCC(C)N/C(=N/Cc1cn(C)nc1-c1ccccc1)NCCc1ccco1 |
| InChI | InChI=1S/C22H29N5O/c1-4-17(2)25-22(23-13-12-20-11-8-14-28-20)24-15-19-16-27(3)26-21(19)18-9-6-5-7-10-18/h5-11,14,16-17H,4,12-13,15H2,1-3H3,(H2,23,24,25) |
| InChIKey | BNFARFSAZDAOEB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 67.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|