C20H21ClFN3O2S — CID 110052318
1-[2-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine (PubChem CID 110052318) has the molecular formula C20H21ClFN3O2S and a molecular weight of 421.93 g/mol. Its IUPAC name is 1-[2-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-[2-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110052318 |
| Molecular Formula | C20H21ClFN3O2S |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 1-[2-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine |
| SMILES | OC(CN/C(=N/Cc1cccs1)NCCc1ccco1)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C20H21ClFN3O2S/c21-17-6-5-14(11-18(17)22)19(26)13-25-20(24-12-16-4-2-10-28-16)23-8-7-15-3-1-9-27-15/h1-6,9-11,19,26H,7-8,12-13H2,(H2,23,24,25) |
| InChIKey | DTZKLRYMUXUKIV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|