C17H26F2N4O2S — CID 110045779
2-[[N'-[[2-(difluoromethoxy)-5-methylphenyl]methyl]-N-(2-methylsulfanylethyl)carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 110045779) has the molecular formula C17H26F2N4O2S and a molecular weight of 388.48 g/mol. Its IUPAC name is 2-[[N'-[[2-(difluoromethoxy)-5-methylphenyl]methyl]-N-(2-methylsulfanylethyl)carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N'-[[2-(difluoromethoxy)-5-methylphenyl]methyl]-N-(2-methylsulfanylethyl)carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110045779 |
| Molecular Formula | C17H26F2N4O2S |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 2-[[N'-[[2-(difluoromethoxy)-5-methylphenyl]methyl]-N-(2-methylsulfanylethyl)carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | CSCCN/C(=N\Cc1cc(C)ccc1OC(F)F)NCC(=O)N(C)C |
| InChI | InChI=1S/C17H26F2N4O2S/c1-12-5-6-14(25-16(18)19)13(9-12)10-21-17(20-7-8-26-4)22-11-15(24)23(2)3/h5-6,9,16H,7-8,10-11H2,1-4H3,(H2,20,21,22) |
| InChIKey | KJVCZGWFBVOMNI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|