C18H26F2N4O4 — CID 110045947
2-[[N-butan-2-yl-N'-[[6-(difluoromethoxy)-1,3-benzodioxol-5-yl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 110045947) has the molecular formula C18H26F2N4O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is 2-[[N-butan-2-yl-N'-[[6-(difluoromethoxy)-1,3-benzodioxol-5-yl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N-butan-2-yl-N'-[[6-(difluoromethoxy)-1,3-benzodioxol-5-yl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110045947 |
| Molecular Formula | C18H26F2N4O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 2-[[N-butan-2-yl-N'-[[6-(difluoromethoxy)-1,3-benzodioxol-5-yl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | CCC(C)N/C(=N/Cc1cc2c(cc1OC(F)F)OCO2)NCC(=O)N(C)C |
| InChI | InChI=1S/C18H26F2N4O4/c1-5-11(2)23-18(22-9-16(25)24(3)4)21-8-12-6-14-15(27-10-26-14)7-13(12)28-17(19)20/h6-7,11,17H,5,8-10H2,1-4H3,(H2,21,22,23) |
| InChIKey | HJVFMMNYVBITHK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|