C17H25F4IN4O — CID 111545082
2-[[N-butan-2-yl-N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111545082) has the molecular formula C17H25F4IN4O and a molecular weight of 504.31 g/mol. Its IUPAC name is 2-[[N-butan-2-yl-N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N-butan-2-yl-N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111545082 |
| Molecular Formula | C17H25F4IN4O |
| Molecular Weight | 504.31 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | 2-[[N-butan-2-yl-N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCC(C)N/C(=N/Cc1ccc(F)cc1C(F)(F)F)NCC(=O)N(C)C.I |
| InChI | InChI=1S/C17H24F4N4O.HI/c1-5-11(2)24-16(23-10-15(26)25(3)4)22-9-12-6-7-13(18)8-14(12)17(19,20)21;/h6-8,11H,5,9-10H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | RDZKPPUPDHKYNJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|