C19H27F4IN4O2 — CID 110035378
2-[[N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N-(oxan-2-ylmethyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110035378) has the molecular formula C19H27F4IN4O2 and a molecular weight of 546.35 g/mol. Its IUPAC name is 2-[[N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N-(oxan-2-ylmethyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N-(oxan-2-ylmethyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110035378 |
| Molecular Formula | C19H27F4IN4O2 |
| Molecular Weight | 546.35 g/mol |
| Exact Mass | 546.11 |
| IUPAC Name | 2-[[N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N-(oxan-2-ylmethyl)carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CN(C)C(=O)CN/C(=N\Cc1ccc(F)cc1C(F)(F)F)NCC1CCCCO1.I |
| InChI | InChI=1S/C19H26F4N4O2.HI/c1-27(2)17(28)12-26-18(25-11-15-5-3-4-8-29-15)24-10-13-6-7-14(20)9-16(13)19(21,22)23;/h6-7,9,15H,3-5,8,10-12H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | JBYVXEJTSMHSOE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|