C18H26Cl2N4O2 — CID 111903595
2-[[N'-[(2,4-dichlorophenyl)methyl]-N-(oxan-2-ylmethyl)carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 111903595) has the molecular formula C18H26Cl2N4O2 and a molecular weight of 401.34 g/mol. Its IUPAC name is 2-[[N'-[(2,4-dichlorophenyl)methyl]-N-(oxan-2-ylmethyl)carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N'-[(2,4-dichlorophenyl)methyl]-N-(oxan-2-ylmethyl)carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111903595 |
| Molecular Formula | C18H26Cl2N4O2 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 2-[[N'-[(2,4-dichlorophenyl)methyl]-N-(oxan-2-ylmethyl)carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN/C(=N\Cc1ccc(Cl)cc1Cl)NCC1CCCCO1 |
| InChI | InChI=1S/C18H26Cl2N4O2/c1-24(2)17(25)12-23-18(22-11-15-5-3-4-8-26-15)21-10-13-6-7-14(19)9-16(13)20/h6-7,9,15H,3-5,8,10-12H2,1-2H3,(H2,21,22,23) |
| InChIKey | NISKJYFYJVFQQJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|