C19H30N4O3 — CID 111654528
2-[[N'-[(2-ethoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 111654528) has the molecular formula C19H30N4O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-[[N'-[(2-ethoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N'-[(2-ethoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111654528 |
| Molecular Formula | C19H30N4O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | 2-[[N'-[(2-ethoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | CCOc1ccccc1C/N=C(\NCC(=O)N(C)C)NCC1CCCO1 |
| InChI | InChI=1S/C19H30N4O3/c1-4-25-17-10-6-5-8-15(17)12-20-19(22-14-18(24)23(2)3)21-13-16-9-7-11-26-16/h5-6,8,10,16H,4,7,9,11-14H2,1-3H3,(H2,20,21,22) |
| InChIKey | NLQBKIHVVOMVEG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|