C20H25IN4O4 — CID 111202939
2-[(3,4-dimethoxyphenyl)methyl]-1-[(4-nitrophenyl)methyl]-3-prop-2-enylguanidine;hydroiodide (PubChem CID 111202939) has the molecular formula C20H25IN4O4 and a molecular weight of 512.35 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-[(4-nitrophenyl)methyl]-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[(4-nitrophenyl)methyl]-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111202939 |
| Molecular Formula | C20H25IN4O4 |
| Molecular Weight | 512.35 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[(4-nitrophenyl)methyl]-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N\Cc1ccc(OC)c(OC)c1)NCc1ccc([N+](=O)[O-])cc1.I |
| InChI | InChI=1S/C20H24N4O4.HI/c1-4-11-21-20(22-13-15-5-8-17(9-6-15)24(25)26)23-14-16-7-10-18(27-2)19(12-16)28-3;/h4-10,12H,1,11,13-14H2,2-3H3,(H2,21,22,23);1H |
| InChIKey | JACJXTPIKWPFHU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|