C17H20IN5O2 — CID 110969695
2-[(4-nitrophenyl)methyl]-1-prop-2-enyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110969695) has the molecular formula C17H20IN5O2 and a molecular weight of 453.28 g/mol. Its IUPAC name is 2-[(4-nitrophenyl)methyl]-1-prop-2-enyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[(4-nitrophenyl)methyl]-1-prop-2-enyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110969695 |
| Molecular Formula | C17H20IN5O2 |
| Molecular Weight | 453.28 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | 2-[(4-nitrophenyl)methyl]-1-prop-2-enyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C=CCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)NCc1ccccn1.I |
| InChI | InChI=1S/C17H19N5O2.HI/c1-2-10-19-17(21-13-15-5-3-4-11-18-15)20-12-14-6-8-16(9-7-14)22(23)24;/h2-9,11H,1,10,12-13H2,(H2,19,20,21);1H |
| InChIKey | UQOJVGLRIARUPO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|