C24H28N6O2 — CID 110969716
1-[3-(N-methylanilino)propyl]-2-[(4-nitrophenyl)methyl]-3-(pyridin-2-ylmethyl)guanidine (PubChem CID 110969716) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 1-[3-(N-methylanilino)propyl]-2-[(4-nitrophenyl)methyl]-3-(pyridin-2-ylmethyl)guanidine.
| Compound Name | 1-[3-(N-methylanilino)propyl]-2-[(4-nitrophenyl)methyl]-3-(pyridin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110969716 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 1-[3-(N-methylanilino)propyl]-2-[(4-nitrophenyl)methyl]-3-(pyridin-2-ylmethyl)guanidine |
| SMILES | CN(CCCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)NCc1ccccn1)c1ccccc1 |
| InChI | InChI=1S/C24H28N6O2/c1-29(22-9-3-2-4-10-22)17-7-16-26-24(28-19-21-8-5-6-15-25-21)27-18-20-11-13-23(14-12-20)30(31)32/h2-6,8-15H,7,16-19H2,1H3,(H2,26,27,28) |
| InChIKey | VZVKSYQIGOXQLC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|