C17H20N4O2S — CID 8657617
1-[3-(N-methylanilino)propyl]-3-(4-nitrophenyl)thiourea (PubChem CID 8657617) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 1-[3-(N-methylanilino)propyl]-3-(4-nitrophenyl)thiourea.
| Compound Name | 1-[3-(N-methylanilino)propyl]-3-(4-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 8657617 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-[3-(N-methylanilino)propyl]-3-(4-nitrophenyl)thiourea |
| SMILES | CN(CCCNC(=S)Nc1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C17H20N4O2S/c1-20(15-6-3-2-4-7-15)13-5-12-18-17(24)19-14-8-10-16(11-9-14)21(22)23/h2-4,6-11H,5,12-13H2,1H3,(H2,18,19,24) |
| InChIKey | IPDGYEAMHDZAEN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 70.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_A(12)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|